C13H12BrCl2NO2 — CID 169496927
tert-butyl 3-bromo-6,7-dichloroindole-1-carboxylate (PubChem CID 169496927) has the molecular formula C13H12BrCl2NO2 and a molecular weight of 365.05 g/mol. Its IUPAC name is tert-butyl 3-bromo-6,7-dichloroindole-1-carboxylate.
| Compound Name | tert-butyl 3-bromo-6,7-dichloroindole-1-carboxylate |
|---|---|
| PubChem CID | 169496927 |
| Molecular Formula | C13H12BrCl2NO2 |
| Molecular Weight | 365.05 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | tert-butyl 3-bromo-6,7-dichloroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(Br)c2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C13H12BrCl2NO2/c1-13(2,3)19-12(18)17-6-8(14)7-4-5-9(15)10(16)11(7)17/h4-6H,1-3H3 |
| InChIKey | LNYVSUSQCKWFOW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.05 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |