C15H17BrClNO2 — CID 169209538
tert-butyl 4-bromo-3-chloro-5,7-dimethylindole-1-carboxylate (PubChem CID 169209538) has the molecular formula C15H17BrClNO2 and a molecular weight of 358.66 g/mol. Its IUPAC name is tert-butyl 4-bromo-3-chloro-5,7-dimethylindole-1-carboxylate.
| Compound Name | tert-butyl 4-bromo-3-chloro-5,7-dimethylindole-1-carboxylate |
|---|---|
| PubChem CID | 169209538 |
| Molecular Formula | C15H17BrClNO2 |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | tert-butyl 4-bromo-3-chloro-5,7-dimethylindole-1-carboxylate |
| SMILES | Cc1cc(C)c2c(c(Cl)cn2C(=O)OC(C)(C)C)c1Br |
| InChI | InChI=1S/C15H17BrClNO2/c1-8-6-9(2)13-11(12(8)16)10(17)7-18(13)14(19)20-15(3,4)5/h6-7H,1-5H3 |
| InChIKey | SEBGLNFKFNWJQK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |