C15H19NO3 — CID 176939664
tert-butyl 5-hydroxy-4,7-dimethylindole-1-carboxylate (PubChem CID 176939664) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is tert-butyl 5-hydroxy-4,7-dimethylindole-1-carboxylate.
| Compound Name | tert-butyl 5-hydroxy-4,7-dimethylindole-1-carboxylate |
|---|---|
| PubChem CID | 176939664 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | tert-butyl 5-hydroxy-4,7-dimethylindole-1-carboxylate |
| SMILES | Cc1c(O)cc(C)c2c1ccn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19NO3/c1-9-8-12(17)10(2)11-6-7-16(13(9)11)14(18)19-15(3,4)5/h6-8,17H,1-5H3 |
| InChIKey | MGARYLUDBSWCCT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |