C18H26IN3O3 — CID 176939592
tert-butyl 4-[[2-aminoethyl(iodo)amino]methyl]-5-methoxy-7-methylindole-1-carboxylate (PubChem CID 176939592) has the molecular formula C18H26IN3O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is tert-butyl 4-[[2-aminoethyl(iodo)amino]methyl]-5-methoxy-7-methylindole-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-aminoethyl(iodo)amino]methyl]-5-methoxy-7-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 176939592 |
| Molecular Formula | C18H26IN3O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | tert-butyl 4-[[2-aminoethyl(iodo)amino]methyl]-5-methoxy-7-methylindole-1-carboxylate |
| SMILES | COc1cc(C)c2c(ccn2C(=O)OC(C)(C)C)c1CN(I)CCN |
| InChI | InChI=1S/C18H26IN3O3/c1-12-10-15(24-5)14(11-21(19)9-7-20)13-6-8-22(16(12)13)17(23)25-18(2,3)4/h6,8,10H,7,9,11,20H2,1-5H3 |
| InChIKey | SKKJZGOGNLEQEY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|