C20H20BrNO3 — CID 44717060
tert-butyl 3-bromo-7-phenylmethoxyindole-1-carboxylate (PubChem CID 44717060) has the molecular formula C20H20BrNO3 and a molecular weight of 402.29 g/mol. Its IUPAC name is tert-butyl 3-bromo-7-phenylmethoxyindole-1-carboxylate.
| Compound Name | tert-butyl 3-bromo-7-phenylmethoxyindole-1-carboxylate |
|---|---|
| PubChem CID | 44717060 |
| Molecular Formula | C20H20BrNO3 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | tert-butyl 3-bromo-7-phenylmethoxyindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(Br)c2cccc(OCc3ccccc3)c21 |
| InChI | InChI=1S/C20H20BrNO3/c1-20(2,3)25-19(23)22-12-16(21)15-10-7-11-17(18(15)22)24-13-14-8-5-4-6-9-14/h4-12H,13H2,1-3H3 |
| InChIKey | LPLKQYAKUPQJCO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |