C21H26BrClN2O2 — CID 170521429
tert-butyl 4-bromo-5-chloro-3-[[(3S,6R)-1,3-dimethyl-3,6-dihydro-2H-pyridin-6-yl]methyl]indole-1-carboxylate (PubChem CID 170521429) has the molecular formula C21H26BrClN2O2 and a molecular weight of 453.81 g/mol. Its IUPAC name is tert-butyl 4-bromo-5-chloro-3-[[(3S,6R)-1,3-dimethyl-3,6-dihydro-2H-pyridin-6-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 4-bromo-5-chloro-3-[[(3S,6R)-1,3-dimethyl-3,6-dihydro-2H-pyridin-6-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 170521429 |
| Molecular Formula | C21H26BrClN2O2 |
| Molecular Weight | 453.81 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | tert-butyl 4-bromo-5-chloro-3-[[(3S,6R)-1,3-dimethyl-3,6-dihydro-2H-pyridin-6-yl]methyl]indole-1-carboxylate |
| SMILES | C[C@H]1C=C[C@@H](Cc2cn(C(=O)OC(C)(C)C)c3ccc(Cl)c(Br)c23)N(C)C1 |
| InChI | InChI=1S/C21H26BrClN2O2/c1-13-6-7-15(24(5)11-13)10-14-12-25(20(26)27-21(2,3)4)17-9-8-16(23)19(22)18(14)17/h6-9,12-13,15H,10-11H2,1-5H3/t13-,15-/m0/s1 |
| InChIKey | HTBUXBNEPGBVBF-ZFWWWQNUSA-N |
| XLogP | 5.89 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.81 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|