C17H18N2O3 — CID 18617754
tert-butyl 3-cyano-5-(2-oxopropyl)indole-1-carboxylate (PubChem CID 18617754) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is tert-butyl 3-cyano-5-(2-oxopropyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-cyano-5-(2-oxopropyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 18617754 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | tert-butyl 3-cyano-5-(2-oxopropyl)indole-1-carboxylate |
| SMILES | CC(=O)Cc1ccc2c(c1)c(C#N)cn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H18N2O3/c1-11(20)7-12-5-6-15-14(8-12)13(9-18)10-19(15)16(21)22-17(2,3)4/h5-6,8,10H,7H2,1-4H3 |
| InChIKey | WJDKIELPQWKIKK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |