C17H22N2O4 — CID 167468165
tert-butyl 3-acetamido-5-(2-hydroxyethyl)indole-1-carboxylate (PubChem CID 167468165) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl 3-acetamido-5-(2-hydroxyethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-acetamido-5-(2-hydroxyethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 167468165 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | tert-butyl 3-acetamido-5-(2-hydroxyethyl)indole-1-carboxylate |
| SMILES | CC(=O)Nc1cn(C(=O)OC(C)(C)C)c2ccc(CCO)cc12 |
| InChI | InChI=1S/C17H22N2O4/c1-11(21)18-14-10-19(16(22)23-17(2,3)4)15-6-5-12(7-8-20)9-13(14)15/h5-6,9-10,20H,7-8H2,1-4H3,(H,18,21) |
| InChIKey | NJHRWZAQJVBHEB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |