C25H25N3O5 — CID 167467968
tert-butyl 3-acetamido-5-[2-(1,3-dioxoisoindol-2-yl)ethyl]indole-1-carboxylate (PubChem CID 167467968) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is tert-butyl 3-acetamido-5-[2-(1,3-dioxoisoindol-2-yl)ethyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-acetamido-5-[2-(1,3-dioxoisoindol-2-yl)ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 167467968 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | tert-butyl 3-acetamido-5-[2-(1,3-dioxoisoindol-2-yl)ethyl]indole-1-carboxylate |
| SMILES | CC(=O)Nc1cn(C(=O)OC(C)(C)C)c2ccc(CCN3C(=O)c4ccccc4C3=O)cc12 |
| InChI | InChI=1S/C25H25N3O5/c1-15(29)26-20-14-28(24(32)33-25(2,3)4)21-10-9-16(13-19(20)21)11-12-27-22(30)17-7-5-6-8-18(17)23(27)31/h5-10,13-14H,11-12H2,1-4H3,(H,26,29) |
| InChIKey | LWWBAWBCKJNJNV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|