C21H19N3O3 — CID 12803132
N-[[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1-methylindol-5-yl]methyl]formamide (PubChem CID 12803132) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1-methylindol-5-yl]methyl]formamide.
| Compound Name | N-[[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1-methylindol-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 12803132 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1-methylindol-5-yl]methyl]formamide |
| SMILES | Cn1cc(CCN2C(=O)c3ccccc3C2=O)c2cc(CNC=O)ccc21 |
| InChI | InChI=1S/C21H19N3O3/c1-23-12-15(18-10-14(11-22-13-25)6-7-19(18)23)8-9-24-20(26)16-4-2-3-5-17(16)21(24)27/h2-7,10,12-13H,8-9,11H2,1H3,(H,22,25) |
| InChIKey | QAXROGZQCMRLFW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|