C27H42N2O5 — CID 67247264
tert-butyl 3-[2-acetamido-3-hydroxy-2-(hydroxymethyl)propyl]-6-octylindole-1-carboxylate (PubChem CID 67247264) has the molecular formula C27H42N2O5 and a molecular weight of 474.64 g/mol. Its IUPAC name is tert-butyl 3-[2-acetamido-3-hydroxy-2-(hydroxymethyl)propyl]-6-octylindole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-acetamido-3-hydroxy-2-(hydroxymethyl)propyl]-6-octylindole-1-carboxylate |
|---|---|
| PubChem CID | 67247264 |
| Molecular Formula | C27H42N2O5 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | tert-butyl 3-[2-acetamido-3-hydroxy-2-(hydroxymethyl)propyl]-6-octylindole-1-carboxylate |
| SMILES | CCCCCCCCc1ccc2c(CC(CO)(CO)NC(C)=O)cn(C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C27H42N2O5/c1-6-7-8-9-10-11-12-21-13-14-23-22(16-27(18-30,19-31)28-20(2)32)17-29(24(23)15-21)25(33)34-26(3,4)5/h13-15,17,30-31H,6-12,16,18-19H2,1-5H3,(H,28,32) |
| InChIKey | IYWZTMHWMWDNHB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|