C28H33ClFN3O5 — CID 143274790
tert-butyl 3-(6-acetyloxy-7-methoxyquinazolin-4-yl)-5-chloro-6-fluoroindole-1-carboxylate;ethane (PubChem CID 143274790) has the molecular formula C28H33ClFN3O5 and a molecular weight of 546.04 g/mol. Its IUPAC name is tert-butyl 3-(6-acetyloxy-7-methoxyquinazolin-4-yl)-5-chloro-6-fluoroindole-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-(6-acetyloxy-7-methoxyquinazolin-4-yl)-5-chloro-6-fluoroindole-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143274790 |
| Molecular Formula | C28H33ClFN3O5 |
| Molecular Weight | 546.04 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | tert-butyl 3-(6-acetyloxy-7-methoxyquinazolin-4-yl)-5-chloro-6-fluoroindole-1-carboxylate;ethane |
| SMILES | CC.CC.COc1cc2ncnc(-c3cn(C(=O)OC(C)(C)C)c4cc(F)c(Cl)cc34)c2cc1OC(C)=O |
| InChI | InChI=1S/C24H21ClFN3O5.2C2H6/c1-12(30)33-21-7-14-18(9-20(21)32-5)27-11-28-22(14)15-10-29(23(31)34-24(2,3)4)19-8-17(26)16(25)6-13(15)19;2*1-2/h6-11H,1-5H3;2*1-2H3 |
| InChIKey | WJPBJWNWCHWSTK-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.04 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|