C19H26FN5O3 — CID 174329612
tert-butyl (3S)-4-[4-(fluoroamino)-7-methoxyquinazolin-6-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 174329612) has the molecular formula C19H26FN5O3 and a molecular weight of 391.45 g/mol. Its IUPAC name is tert-butyl (3S)-4-[4-(fluoroamino)-7-methoxyquinazolin-6-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[4-(fluoroamino)-7-methoxyquinazolin-6-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 174329612 |
| Molecular Formula | C19H26FN5O3 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | tert-butyl (3S)-4-[4-(fluoroamino)-7-methoxyquinazolin-6-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | COc1cc2ncnc(NF)c2cc1N1CCN(C(=O)OC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C19H26FN5O3/c1-12-10-24(18(26)28-19(2,3)4)6-7-25(12)15-8-13-14(9-16(15)27-5)21-11-22-17(13)23-20/h8-9,11-12H,6-7,10H2,1-5H3,(H,21,22,23)/t12-/m0/s1 |
| InChIKey | PIGODPOCSXIOSP-LBPRGKRZSA-N |
| XLogP | 3.38 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|