C20H21F2N3O2 — CID 53275141
tert-butyl 3-(2,5-difluorophenyl)-4-(hydrazinylmethyl)indole-1-carboxylate (PubChem CID 53275141) has the molecular formula C20H21F2N3O2 and a molecular weight of 373.40 g/mol. Its IUPAC name is tert-butyl 3-(2,5-difluorophenyl)-4-(hydrazinylmethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(2,5-difluorophenyl)-4-(hydrazinylmethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 53275141 |
| Molecular Formula | C20H21F2N3O2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl 3-(2,5-difluorophenyl)-4-(hydrazinylmethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2cc(F)ccc2F)c2c(CNN)cccc21 |
| InChI | InChI=1S/C20H21F2N3O2/c1-20(2,3)27-19(26)25-11-15(14-9-13(21)7-8-16(14)22)18-12(10-24-23)5-4-6-17(18)25/h4-9,11,24H,10,23H2,1-3H3 |
| InChIKey | LGVBCHSGPKHDKI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|