C21H17BrN4O3 — CID 25223202
tert-butyl 3-(bromomethyl)-4-(3,5-dicyanophenoxy)indazole-1-carboxylate (PubChem CID 25223202) has the molecular formula C21H17BrN4O3 and a molecular weight of 453.30 g/mol. Its IUPAC name is tert-butyl 3-(bromomethyl)-4-(3,5-dicyanophenoxy)indazole-1-carboxylate.
| Compound Name | tert-butyl 3-(bromomethyl)-4-(3,5-dicyanophenoxy)indazole-1-carboxylate |
|---|---|
| PubChem CID | 25223202 |
| Molecular Formula | C21H17BrN4O3 |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | tert-butyl 3-(bromomethyl)-4-(3,5-dicyanophenoxy)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(CBr)c2c(Oc3cc(C#N)cc(C#N)c3)cccc21 |
| InChI | InChI=1S/C21H17BrN4O3/c1-21(2,3)29-20(27)26-17-5-4-6-18(19(17)16(10-22)25-26)28-15-8-13(11-23)7-14(9-15)12-24/h4-9H,10H2,1-3H3 |
| InChIKey | COSCTTAKOGFACD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 100.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|