C16H16BrN3O2 — CID 89082829
tert-butyl 5-(bromomethyl)-3-(3-cyanophenyl)pyrazole-1-carboxylate (PubChem CID 89082829) has the molecular formula C16H16BrN3O2 and a molecular weight of 362.23 g/mol. Its IUPAC name is tert-butyl 5-(bromomethyl)-3-(3-cyanophenyl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-(bromomethyl)-3-(3-cyanophenyl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 89082829 |
| Molecular Formula | C16H16BrN3O2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | tert-butyl 5-(bromomethyl)-3-(3-cyanophenyl)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(-c2cccc(C#N)c2)cc1CBr |
| InChI | InChI=1S/C16H16BrN3O2/c1-16(2,3)22-15(21)20-13(9-17)8-14(19-20)12-6-4-5-11(7-12)10-18/h4-8H,9H2,1-3H3 |
| InChIKey | ACAXBIOSKPETQE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|