C24H35N5O6 — CID 57444044
tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonyl-(2-piperidin-1-ylethyl)amino]-6-nitroindazole-1-carboxylate (PubChem CID 57444044) has the molecular formula C24H35N5O6 and a molecular weight of 489.57 g/mol. Its IUPAC name is tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonyl-(2-piperidin-1-ylethyl)amino]-6-nitroindazole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonyl-(2-piperidin-1-ylethyl)amino]-6-nitroindazole-1-carboxylate |
|---|---|
| PubChem CID | 57444044 |
| Molecular Formula | C24H35N5O6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonyl-(2-piperidin-1-ylethyl)amino]-6-nitroindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(CCN1CCCCC1)c1nn(C(=O)OC(C)(C)C)c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C24H35N5O6/c1-23(2,3)34-21(30)27(15-14-26-12-8-7-9-13-26)20-18-11-10-17(29(32)33)16-19(18)28(25-20)22(31)35-24(4,5)6/h10-11,16H,7-9,12-15H2,1-6H3 |
| InChIKey | RBIYITFOVGHGHA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 120.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|