C17H20N4O4 — CID 165381988
tert-butyl 6-nitro-3-(1,2,3,6-tetrahydropyridin-4-yl)indazole-1-carboxylate (PubChem CID 165381988) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is tert-butyl 6-nitro-3-(1,2,3,6-tetrahydropyridin-4-yl)indazole-1-carboxylate.
| Compound Name | tert-butyl 6-nitro-3-(1,2,3,6-tetrahydropyridin-4-yl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 165381988 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | tert-butyl 6-nitro-3-(1,2,3,6-tetrahydropyridin-4-yl)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(C2=CCNCC2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H20N4O4/c1-17(2,3)25-16(22)20-14-10-12(21(23)24)4-5-13(14)15(19-20)11-6-8-18-9-7-11/h4-6,10,18H,7-9H2,1-3H3 |
| InChIKey | RKLIQYHQBURTTG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|