C18H25N3O5S — CID 141143511
tert-butyl 3-cyclohexyl-6-sulfamoyloxyindazole-1-carboxylate (PubChem CID 141143511) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is tert-butyl 3-cyclohexyl-6-sulfamoyloxyindazole-1-carboxylate.
| Compound Name | tert-butyl 3-cyclohexyl-6-sulfamoyloxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 141143511 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl 3-cyclohexyl-6-sulfamoyloxyindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(C2CCCCC2)c2ccc(OS(N)(=O)=O)cc21 |
| InChI | InChI=1S/C18H25N3O5S/c1-18(2,3)25-17(22)21-15-11-13(26-27(19,23)24)9-10-14(15)16(20-21)12-7-5-4-6-8-12/h9-12H,4-8H2,1-3H3,(H2,19,23,24) |
| InChIKey | SXAJGAWXNFAFPK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |