C24H28BrN3O5S — CID 71682147
tert-butyl 6-bromo-5-cyclohexyloxy-3-(3-sulfamoylphenyl)indazole-1-carboxylate (PubChem CID 71682147) has the molecular formula C24H28BrN3O5S and a molecular weight of 550.48 g/mol. Its IUPAC name is tert-butyl 6-bromo-5-cyclohexyloxy-3-(3-sulfamoylphenyl)indazole-1-carboxylate.
| Compound Name | tert-butyl 6-bromo-5-cyclohexyloxy-3-(3-sulfamoylphenyl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 71682147 |
| Molecular Formula | C24H28BrN3O5S |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | tert-butyl 6-bromo-5-cyclohexyloxy-3-(3-sulfamoylphenyl)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(-c2cccc(S(N)(=O)=O)c2)c2cc(OC3CCCCC3)c(Br)cc21 |
| InChI | InChI=1S/C24H28BrN3O5S/c1-24(2,3)33-23(29)28-20-14-19(25)21(32-16-9-5-4-6-10-16)13-18(20)22(27-28)15-8-7-11-17(12-15)34(26,30)31/h7-8,11-14,16H,4-6,9-10H2,1-3H3,(H2,26,30,31) |
| InChIKey | UAOFGJDFVLQCLL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |