C17H23N3O2 — CID 168797696
tert-butyl 4-imidazo[1,2-a]pyridin-2-ylpiperidine-1-carboxylate (PubChem CID 168797696) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl 4-imidazo[1,2-a]pyridin-2-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-imidazo[1,2-a]pyridin-2-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 168797696 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | tert-butyl 4-imidazo[1,2-a]pyridin-2-ylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cn3ccccc3n2)CC1 |
| InChI | InChI=1S/C17H23N3O2/c1-17(2,3)22-16(21)19-10-7-13(8-11-19)14-12-20-9-5-4-6-15(20)18-14/h4-6,9,12-13H,7-8,10-11H2,1-3H3 |
| InChIKey | ZIFLPQBFWWFHNA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |