C17H21F3N2O3 — CID 166078752
tert-butyl 4-[6-formyl-5-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 166078752) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is tert-butyl 4-[6-formyl-5-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-formyl-5-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166078752 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | tert-butyl 4-[6-formyl-5-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cnc(C=O)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-16(2,3)25-15(24)22-6-4-11(5-7-22)12-8-13(17(18,19)20)14(10-23)21-9-12/h8-11H,4-7H2,1-3H3 |
| InChIKey | WRPRGAOHYXJUIS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|