C18H25F3N2O3 — CID 178111899
tert-butyl 4-[[6-methoxy-4-(trifluoromethyl)-3-pyridinyl]methyl]piperidine-1-carboxylate (PubChem CID 178111899) has the molecular formula C18H25F3N2O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is tert-butyl 4-[[6-methoxy-4-(trifluoromethyl)-3-pyridinyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-methoxy-4-(trifluoromethyl)-3-pyridinyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178111899 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl 4-[[6-methoxy-4-(trifluoromethyl)-3-pyridinyl]methyl]piperidine-1-carboxylate |
| SMILES | COc1cc(C(F)(F)F)c(CC2CCN(C(=O)OC(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C18H25F3N2O3/c1-17(2,3)26-16(24)23-7-5-12(6-8-23)9-13-11-22-15(25-4)10-14(13)18(19,20)21/h10-12H,5-9H2,1-4H3 |
| InChIKey | HUVNWUBVGLDOQI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |