C16H21F3N2O3 — CID 178111804
tert-butyl 3-[[6-methoxy-4-(trifluoromethyl)-3-pyridinyl]methyl]azetidine-1-carboxylate (PubChem CID 178111804) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is tert-butyl 3-[[6-methoxy-4-(trifluoromethyl)-3-pyridinyl]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[6-methoxy-4-(trifluoromethyl)-3-pyridinyl]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 178111804 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | tert-butyl 3-[[6-methoxy-4-(trifluoromethyl)-3-pyridinyl]methyl]azetidine-1-carboxylate |
| SMILES | COc1cc(C(F)(F)F)c(CC2CN(C(=O)OC(C)(C)C)C2)cn1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-15(2,3)24-14(22)21-8-10(9-21)5-11-7-20-13(23-4)6-12(11)16(17,18)19/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | UXUZKLSIBAAUGD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |