C15H18ClF3N2O3 — CID 146380661
tert-butyl 3-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxymethyl]azetidine-1-carboxylate (PubChem CID 146380661) has the molecular formula C15H18ClF3N2O3 and a molecular weight of 366.77 g/mol. Its IUPAC name is tert-butyl 3-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 146380661 |
| Molecular Formula | C15H18ClF3N2O3 |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | tert-butyl 3-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(COc2cc(C(F)(F)F)cc(Cl)n2)C1 |
| InChI | InChI=1S/C15H18ClF3N2O3/c1-14(2,3)24-13(22)21-6-9(7-21)8-23-12-5-10(15(17,18)19)4-11(16)20-12/h4-5,9H,6-8H2,1-3H3 |
| InChIKey | GGUZHUDJYKUJLC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|