C16H19ClF4N2O2 — CID 178042227
tert-butyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-fluoropiperidine-1-carboxylate (PubChem CID 178042227) has the molecular formula C16H19ClF4N2O2 and a molecular weight of 382.79 g/mol. Its IUPAC name is tert-butyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 178042227 |
| Molecular Formula | C16H19ClF4N2O2 |
| Molecular Weight | 382.79 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | tert-butyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(C(F)(F)F)cc(Cl)n2)C(F)C1 |
| InChI | InChI=1S/C16H19ClF4N2O2/c1-15(2,3)25-14(24)23-5-4-10(11(18)8-23)12-6-9(16(19,20)21)7-13(17)22-12/h6-7,10-11H,4-5,8H2,1-3H3 |
| InChIKey | LPCTWEKWWPSQIO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.79 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|