C17H21ClF4N2O2 — CID 178042373
tert-butyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-4-(fluoromethyl)piperidine-1-carboxylate (PubChem CID 178042373) has the molecular formula C17H21ClF4N2O2 and a molecular weight of 396.81 g/mol. Its IUPAC name is tert-butyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-4-(fluoromethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-4-(fluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178042373 |
| Molecular Formula | C17H21ClF4N2O2 |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | tert-butyl 4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-4-(fluoromethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CF)(c2cc(C(F)(F)F)cc(Cl)n2)CC1 |
| InChI | InChI=1S/C17H21ClF4N2O2/c1-15(2,3)26-14(25)24-6-4-16(10-19,5-7-24)12-8-11(17(20,21)22)9-13(18)23-12/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | XUXLCLAEPSXPIL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|