C16H23Br2N3O2 — CID 59818102
tert-butyl 4-[(3-amino-2,6-dibromo-4-pyridinyl)methyl]piperidine-1-carboxylate (PubChem CID 59818102) has the molecular formula C16H23Br2N3O2 and a molecular weight of 449.19 g/mol. Its IUPAC name is tert-butyl 4-[(3-amino-2,6-dibromo-4-pyridinyl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-amino-2,6-dibromo-4-pyridinyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59818102 |
| Molecular Formula | C16H23Br2N3O2 |
| Molecular Weight | 449.19 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | tert-butyl 4-[(3-amino-2,6-dibromo-4-pyridinyl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2cc(Br)nc(Br)c2N)CC1 |
| InChI | InChI=1S/C16H23Br2N3O2/c1-16(2,3)23-15(22)21-6-4-10(5-7-21)8-11-9-12(17)20-14(18)13(11)19/h9-10H,4-8,19H2,1-3H3 |
| InChIKey | HXOXYAFMHVFEND-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.19 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|