C20H26N2O2 — CID 174880299
tert-butyl 4-(quinolin-6-ylmethyl)piperidine-1-carboxylate (PubChem CID 174880299) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is tert-butyl 4-(quinolin-6-ylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(quinolin-6-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174880299 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | tert-butyl 4-(quinolin-6-ylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2ccc3ncccc3c2)CC1 |
| InChI | InChI=1S/C20H26N2O2/c1-20(2,3)24-19(23)22-11-8-15(9-12-22)13-16-6-7-18-17(14-16)5-4-10-21-18/h4-7,10,14-15H,8-9,11-13H2,1-3H3 |
| InChIKey | SWBOCEMIGODUTD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |