C19H25NO2S — CID 10496741
tert-butyl 4-(1-benzothiophen-5-ylmethyl)piperidine-1-carboxylate (PubChem CID 10496741) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is tert-butyl 4-(1-benzothiophen-5-ylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-benzothiophen-5-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10496741 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | tert-butyl 4-(1-benzothiophen-5-ylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2ccc3sccc3c2)CC1 |
| InChI | InChI=1S/C19H25NO2S/c1-19(2,3)22-18(21)20-9-6-14(7-10-20)12-15-4-5-17-16(13-15)8-11-23-17/h4-5,8,11,13-14H,6-7,9-10,12H2,1-3H3 |
| InChIKey | XNXKMOWWMBDLFQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |