C22H29NO5 — CID 177363519
tert-butyl 4-[(3-ethoxycarbonyl-1-benzofuran-6-yl)methyl]piperidine-1-carboxylate (PubChem CID 177363519) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl 4-[(3-ethoxycarbonyl-1-benzofuran-6-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-ethoxycarbonyl-1-benzofuran-6-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177363519 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | tert-butyl 4-[(3-ethoxycarbonyl-1-benzofuran-6-yl)methyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)c1coc2cc(CC3CCN(C(=O)OC(C)(C)C)CC3)ccc12 |
| InChI | InChI=1S/C22H29NO5/c1-5-26-20(24)18-14-27-19-13-16(6-7-17(18)19)12-15-8-10-23(11-9-15)21(25)28-22(2,3)4/h6-7,13-15H,5,8-12H2,1-4H3 |
| InChIKey | JHWBCZLZDWRPFC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |