C18H25F3N2O3 — CID 170459041
tert-butyl 4-[3-amino-5-(2,2,2-trifluoroethoxy)phenyl]piperidine-1-carboxylate (PubChem CID 170459041) has the molecular formula C18H25F3N2O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-5-(2,2,2-trifluoroethoxy)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-5-(2,2,2-trifluoroethoxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170459041 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl 4-[3-amino-5-(2,2,2-trifluoroethoxy)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(N)cc(OCC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H25F3N2O3/c1-17(2,3)26-16(24)23-6-4-12(5-7-23)13-8-14(22)10-15(9-13)25-11-18(19,20)21/h8-10,12H,4-7,11,22H2,1-3H3 |
| InChIKey | IPZNNKREXBTZMR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|