C16H22N4O2 — CID 11255100
tert-butyl 4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carboxylate (PubChem CID 11255100) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is tert-butyl 4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11255100 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl 4-imidazo[4,5-b]pyridin-3-ylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cnc3cccnc32)CC1 |
| InChI | InChI=1S/C16H22N4O2/c1-16(2,3)22-15(21)19-9-6-12(7-10-19)20-11-18-13-5-4-8-17-14(13)20/h4-5,8,11-12H,6-7,9-10H2,1-3H3 |
| InChIKey | IUNMOUPPXOSBFD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |