C17H29N3O3 — CID 69192840
tert-butyl 4-[2-(2-hydroxypropan-2-yl)-4-methylimidazol-1-yl]piperidine-1-carboxylate (PubChem CID 69192840) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-hydroxypropan-2-yl)-4-methylimidazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-hydroxypropan-2-yl)-4-methylimidazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69192840 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | tert-butyl 4-[2-(2-hydroxypropan-2-yl)-4-methylimidazol-1-yl]piperidine-1-carboxylate |
| SMILES | Cc1cn(C2CCN(C(=O)OC(C)(C)C)CC2)c(C(C)(C)O)n1 |
| InChI | InChI=1S/C17H29N3O3/c1-12-11-20(14(18-12)17(5,6)22)13-7-9-19(10-8-13)15(21)23-16(2,3)4/h11,13,22H,7-10H2,1-6H3 |
| InChIKey | NTSXSJWDMAJWCG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |