C22H28FN3O2 — CID 90240395
tert-butyl 4-[2-cyclopropyl-4-(4-fluorophenyl)imidazol-1-yl]piperidine-1-carboxylate (PubChem CID 90240395) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is tert-butyl 4-[2-cyclopropyl-4-(4-fluorophenyl)imidazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-cyclopropyl-4-(4-fluorophenyl)imidazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90240395 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | tert-butyl 4-[2-cyclopropyl-4-(4-fluorophenyl)imidazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3ccc(F)cc3)nc2C2CC2)CC1 |
| InChI | InChI=1S/C22H28FN3O2/c1-22(2,3)28-21(27)25-12-10-18(11-13-25)26-14-19(24-20(26)16-4-5-16)15-6-8-17(23)9-7-15/h6-9,14,16,18H,4-5,10-13H2,1-3H3 |
| InChIKey | JYVMBVFAIJPXLO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |