C23H27N3O3 — CID 18321429
tert-butyl 4-(5-naphthalen-2-yl-2-oxo-1H-imidazol-3-yl)piperidine-1-carboxylate (PubChem CID 18321429) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is tert-butyl 4-(5-naphthalen-2-yl-2-oxo-1H-imidazol-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-naphthalen-2-yl-2-oxo-1H-imidazol-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18321429 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl 4-(5-naphthalen-2-yl-2-oxo-1H-imidazol-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3ccc4ccccc4c3)[nH]c2=O)CC1 |
| InChI | InChI=1S/C23H27N3O3/c1-23(2,3)29-22(28)25-12-10-19(11-13-25)26-15-20(24-21(26)27)18-9-8-16-6-4-5-7-17(16)14-18/h4-9,14-15,19H,10-13H2,1-3H3,(H,24,27) |
| InChIKey | RNYLCPUEKRAQSZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |