C28H26Br2N4O3 — CID 21109757
1-(4-amino-3,5-dibromophenyl)-4-[4-(5-naphthalen-2-yl-2-oxo-1H-imidazol-3-yl)piperidin-1-yl]butane-1,4-dione (PubChem CID 21109757) has the molecular formula C28H26Br2N4O3 and a molecular weight of 626.35 g/mol. Its IUPAC name is 1-(4-amino-3,5-dibromophenyl)-4-[4-(5-naphthalen-2-yl-2-oxo-1H-imidazol-3-yl)piperidin-1-yl]butane-1,4-dione.
| Compound Name | 1-(4-amino-3,5-dibromophenyl)-4-[4-(5-naphthalen-2-yl-2-oxo-1H-imidazol-3-yl)piperidin-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 21109757 |
| Molecular Formula | C28H26Br2N4O3 |
| Molecular Weight | 626.35 g/mol |
| Exact Mass | 624.04 |
| IUPAC Name | 1-(4-amino-3,5-dibromophenyl)-4-[4-(5-naphthalen-2-yl-2-oxo-1H-imidazol-3-yl)piperidin-1-yl]butane-1,4-dione |
| SMILES | Nc1c(Br)cc(C(=O)CCC(=O)N2CCC(n3cc(-c4ccc5ccccc5c4)[nH]c3=O)CC2)cc1Br |
| InChI | InChI=1S/C28H26Br2N4O3/c29-22-14-20(15-23(30)27(22)31)25(35)7-8-26(36)33-11-9-21(10-12-33)34-16-24(32-28(34)37)19-6-5-17-3-1-2-4-18(17)13-19/h1-6,13-16,21H,7-12,31H2,(H,32,37) |
| InChIKey | GRJCDLQFYOJESK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.35 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|