C23H27Br2N5O3 — CID 21109787
[2-[[[1-[4-(4-amino-3,5-dibromophenyl)-4-oxobutanoyl]piperidin-4-yl]amino]methyl]phenyl]urea (PubChem CID 21109787) has the molecular formula C23H27Br2N5O3 and a molecular weight of 581.31 g/mol. Its IUPAC name is [2-[[[1-[4-(4-amino-3,5-dibromophenyl)-4-oxobutanoyl]piperidin-4-yl]amino]methyl]phenyl]urea.
| Compound Name | [2-[[[1-[4-(4-amino-3,5-dibromophenyl)-4-oxobutanoyl]piperidin-4-yl]amino]methyl]phenyl]urea |
|---|---|
| PubChem CID | 21109787 |
| Molecular Formula | C23H27Br2N5O3 |
| Molecular Weight | 581.31 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | [2-[[[1-[4-(4-amino-3,5-dibromophenyl)-4-oxobutanoyl]piperidin-4-yl]amino]methyl]phenyl]urea |
| SMILES | NC(=O)Nc1ccccc1CNC1CCN(C(=O)CCC(=O)c2cc(Br)c(N)c(Br)c2)CC1 |
| InChI | InChI=1S/C23H27Br2N5O3/c24-17-11-15(12-18(25)22(17)26)20(31)5-6-21(32)30-9-7-16(8-10-30)28-13-14-3-1-2-4-19(14)29-23(27)33/h1-4,11-12,16,28H,5-10,13,26H2,(H3,27,29,33) |
| InChIKey | XBYLRAYZCQBVFE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|