C25H30N4O3 — CID 143770885
tert-butyl 4-[[3-(hydroxyamino)-4-naphthalen-2-yl-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 143770885) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is tert-butyl 4-[[3-(hydroxyamino)-4-naphthalen-2-yl-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(hydroxyamino)-4-naphthalen-2-yl-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143770885 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | tert-butyl 4-[[3-(hydroxyamino)-4-naphthalen-2-yl-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2nccc(-c3ccc4ccccc4c3)c2NO)CC1 |
| InChI | InChI=1S/C25H30N4O3/c1-25(2,3)32-24(30)29-14-11-20(12-15-29)27-23-22(28-31)21(10-13-26-23)19-9-8-17-6-4-5-7-18(17)16-19/h4-10,13,16,20,28,31H,11-12,14-15H2,1-3H3,(H,26,27) |
| InChIKey | JOVLXRFTBRILPY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|