C18H26N6O2 — CID 139409469
tert-butyl 4-[4-(5-aminopyrazin-2-yl)-3-methylpyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 139409469) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is tert-butyl 4-[4-(5-aminopyrazin-2-yl)-3-methylpyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(5-aminopyrazin-2-yl)-3-methylpyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139409469 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | tert-butyl 4-[4-(5-aminopyrazin-2-yl)-3-methylpyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | Cc1nn(C2CCN(C(=O)OC(C)(C)C)CC2)cc1-c1cnc(N)cn1 |
| InChI | InChI=1S/C18H26N6O2/c1-12-14(15-9-21-16(19)10-20-15)11-24(22-12)13-5-7-23(8-6-13)17(25)26-18(2,3)4/h9-11,13H,5-8H2,1-4H3,(H2,19,21) |
| InChIKey | MWTMTAIVSHJXMP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |