C25H31FN6O4 — CID 170625844
tert-butyl 4-[4-[3-amino-6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]-3-fluoropyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 170625844) has the molecular formula C25H31FN6O4 and a molecular weight of 498.56 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-amino-6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]-3-fluoropyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-amino-6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]-3-fluoropyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170625844 |
| Molecular Formula | C25H31FN6O4 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | tert-butyl 4-[4-[3-amino-6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]-3-fluoropyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | COCOc1ccccc1-c1cc(-c2cn(C3CCN(C(=O)OC(C)(C)C)CC3)nc2F)c(N)nn1 |
| InChI | InChI=1S/C25H31FN6O4/c1-25(2,3)36-24(33)31-11-9-16(10-12-31)32-14-19(22(26)30-32)18-13-20(28-29-23(18)27)17-7-5-6-8-21(17)35-15-34-4/h5-8,13-14,16H,9-12,15H2,1-4H3,(H2,27,29) |
| InChIKey | GSBWBDLHZOHSJY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|