C26H32N6O4 — CID 168902520
tert-butyl 4-[5-[6-(methoxymethoxy)-2-methylindazol-5-yl]pyrazolo[4,3-b]pyridin-2-yl]piperidine-1-carboxylate (PubChem CID 168902520) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is tert-butyl 4-[5-[6-(methoxymethoxy)-2-methylindazol-5-yl]pyrazolo[4,3-b]pyridin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[6-(methoxymethoxy)-2-methylindazol-5-yl]pyrazolo[4,3-b]pyridin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168902520 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | tert-butyl 4-[5-[6-(methoxymethoxy)-2-methylindazol-5-yl]pyrazolo[4,3-b]pyridin-2-yl]piperidine-1-carboxylate |
| SMILES | COCOc1cc2nn(C)cc2cc1-c1ccc2nn(C3CCN(C(=O)OC(C)(C)C)CC3)cc2n1 |
| InChI | InChI=1S/C26H32N6O4/c1-26(2,3)36-25(33)31-10-8-18(9-11-31)32-15-23-21(29-32)7-6-20(27-23)19-12-17-14-30(4)28-22(17)13-24(19)35-16-34-5/h6-7,12-15,18H,8-11,16H2,1-5H3 |
| InChIKey | FYXDNQKWEYMIKB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 96.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|