C25H39N5O3 — CID 170436386
tert-butyl 4-[4-[5-amino-6-(2-hydroxypropan-2-yl)indazol-2-yl]cyclohexyl]piperazine-1-carboxylate (PubChem CID 170436386) has the molecular formula C25H39N5O3 and a molecular weight of 457.62 g/mol. Its IUPAC name is tert-butyl 4-[4-[5-amino-6-(2-hydroxypropan-2-yl)indazol-2-yl]cyclohexyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[5-amino-6-(2-hydroxypropan-2-yl)indazol-2-yl]cyclohexyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170436386 |
| Molecular Formula | C25H39N5O3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | tert-butyl 4-[4-[5-amino-6-(2-hydroxypropan-2-yl)indazol-2-yl]cyclohexyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2CCC(n3cc4cc(N)c(C(C)(C)O)cc4n3)CC2)CC1 |
| InChI | InChI=1S/C25H39N5O3/c1-24(2,3)33-23(31)29-12-10-28(11-13-29)18-6-8-19(9-7-18)30-16-17-14-21(26)20(25(4,5)32)15-22(17)27-30/h14-16,18-19,32H,6-13,26H2,1-5H3 |
| InChIKey | IKNLUPFKUGRUFI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|