C21H21F9N4O7S — CID 170740910
tert-butyl 4-[5-nitro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)indazol-2-yl]piperidine-1-carboxylate (PubChem CID 170740910) has the molecular formula C21H21F9N4O7S and a molecular weight of 644.47 g/mol. Its IUPAC name is tert-butyl 4-[5-nitro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)indazol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-nitro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)indazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170740910 |
| Molecular Formula | C21H21F9N4O7S |
| Molecular Weight | 644.47 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | tert-butyl 4-[5-nitro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)indazol-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc3cc([N+](=O)[O-])c(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3n2)CC1 |
| InChI | InChI=1S/C21H21F9N4O7S/c1-17(2,3)40-16(35)32-6-4-12(5-7-32)33-10-11-8-14(34(36)37)15(9-13(11)31-33)41-42(38,39)21(29,30)19(24,25)18(22,23)20(26,27)28/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | DDUKHGDWGXCLIA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 133.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|