C13H17N3O5S — CID 137377624
2-(1,1-dihydroxythian-4-yl)-6-methoxy-5-nitroindazole (PubChem CID 137377624) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-(1,1-dihydroxythian-4-yl)-6-methoxy-5-nitroindazole.
| Compound Name | 2-(1,1-dihydroxythian-4-yl)-6-methoxy-5-nitroindazole |
|---|---|
| PubChem CID | 137377624 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-(1,1-dihydroxythian-4-yl)-6-methoxy-5-nitroindazole |
| SMILES | COc1cc2nn(C3CCS(O)(O)CC3)cc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N3O5S/c1-21-13-7-11-9(6-12(13)16(17)18)8-15(14-11)10-2-4-22(19,20)5-3-10/h6-8,10,19-20H,2-5H2,1H3 |
| InChIKey | FSOPTMDNXJTCKP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|