C17H22BrN3O3 — CID 169132481
methyl N-[4-(5-bromo-6-methoxyindazol-2-yl)cyclohexyl]-N-methylcarbamate (PubChem CID 169132481) has the molecular formula C17H22BrN3O3 and a molecular weight of 396.29 g/mol. Its IUPAC name is methyl N-[4-(5-bromo-6-methoxyindazol-2-yl)cyclohexyl]-N-methylcarbamate.
| Compound Name | methyl N-[4-(5-bromo-6-methoxyindazol-2-yl)cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 169132481 |
| Molecular Formula | C17H22BrN3O3 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | methyl N-[4-(5-bromo-6-methoxyindazol-2-yl)cyclohexyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)C1CCC(n2cc3cc(Br)c(OC)cc3n2)CC1 |
| InChI | InChI=1S/C17H22BrN3O3/c1-20(17(22)24-3)12-4-6-13(7-5-12)21-10-11-8-14(18)16(23-2)9-15(11)19-21/h8-10,12-13H,4-7H2,1-3H3 |
| InChIKey | HUEPMIFLJZTLKG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |