C16H21BrN2O2 — CID 167108653
4-(5-bromo-6-methoxyindazol-2-yl)-1,3-dimethylcyclohexan-1-ol (PubChem CID 167108653) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 4-(5-bromo-6-methoxyindazol-2-yl)-1,3-dimethylcyclohexan-1-ol.
| Compound Name | 4-(5-bromo-6-methoxyindazol-2-yl)-1,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 167108653 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-(5-bromo-6-methoxyindazol-2-yl)-1,3-dimethylcyclohexan-1-ol |
| SMILES | COc1cc2nn(C3CCC(C)(O)CC3C)cc2cc1Br |
| InChI | InChI=1S/C16H21BrN2O2/c1-10-8-16(2,20)5-4-14(10)19-9-11-6-12(17)15(21-3)7-13(11)18-19/h6-7,9-10,14,20H,4-5,8H2,1-3H3 |
| InChIKey | INWKNAPTDWMIRD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |