C16H17N3O4 — CID 176652685
4-(6-ethenyl-5-nitroindazol-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 176652685) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 4-(6-ethenyl-5-nitroindazol-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(6-ethenyl-5-nitroindazol-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 176652685 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 4-(6-ethenyl-5-nitroindazol-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | C=Cc1cc2nn(C3CCC(C(=O)O)CC3)cc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N3O4/c1-2-10-7-14-12(8-15(10)19(22)23)9-18(17-14)13-5-3-11(4-6-13)16(20)21/h2,7-9,11,13H,1,3-6H2,(H,20,21) |
| InChIKey | JVJPKMKJHATCEP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|