C8H9N3O6S — CID 107345786
1-(1,1-dioxothiolan-3-yl)-4-nitropyrazole-3-carboxylic acid (PubChem CID 107345786) has the molecular formula C8H9N3O6S and a molecular weight of 275.24 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4-nitropyrazole-3-carboxylic acid.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-4-nitropyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107345786 |
| Molecular Formula | C8H9N3O6S |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-4-nitropyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(C2CCS(=O)(=O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9N3O6S/c12-8(13)7-6(11(14)15)3-10(9-7)5-1-2-18(16,17)4-5/h3,5H,1-2,4H2,(H,12,13) |
| InChIKey | RHAIRSZPNIZLFY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|