C6H8IN3O2S — CID 97049415
(3R)-3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide (PubChem CID 97049415) has the molecular formula C6H8IN3O2S and a molecular weight of 313.12 g/mol. Its IUPAC name is (3R)-3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide.
| Compound Name | (3R)-3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 97049415 |
| Molecular Formula | C6H8IN3O2S |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | (3R)-3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H](n2cnc(I)n2)C1 |
| InChI | InChI=1S/C6H8IN3O2S/c7-6-8-4-10(9-6)5-1-2-13(11,12)3-5/h4-5H,1-3H2/t5-/m1/s1 |
| InChIKey | BXDKPOPWJBUHAG-RXMQYKEDSA-N |
| XLogP | 0.24 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|